ChemNet > CAS > 337508-62-0 2,1,3-benzothiadiazol-5-yl isothiocyanate
337508-62-0 2,1,3-benzothiadiazol-5-yl isothiocyanate
| 상품명칭 |
2,1,3-benzothiadiazol-5-yl isothiocyanate |
| 별명 |
5-isothiocyanato-2,1,3-benzothiadiazole |
| 분자식 |
C7H3N3S2 |
| 분자량 |
193.2488 |
| InChI |
InChI=1/C7H3N3S2/c11-4-8-5-1-2-6-7(3-5)10-12-9-6/h1-3H |
| cas번호 |
337508-62-0 |
| 분자 구조 |
|
| 밀도 |
1.54g/cm3 |
| 녹는 점 |
93℃ |
| 비등점 |
332.6°C at 760 mmHg |
| 굴절 지수 |
1.807 |
| 인화점 |
155°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
